C19H28O10S2 — CID 101076927
[(2R)-2-[(3aR,5S,6R,6aR)-2,2-dimethyl-6-(phenylmethoxymethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-methylsulfonyloxyethyl] methanesulfonate (PubChem CID 101076927) has the molecular formula C19H28O10S2 and a molecular weight of 480.56 g/mol. Its IUPAC name is [(2R)-2-[(3aR,5S,6R,6aR)-2,2-dimethyl-6-(phenylmethoxymethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-methylsulfonyloxyethyl] methanesulfonate.
| Compound Name | [(2R)-2-[(3aR,5S,6R,6aR)-2,2-dimethyl-6-(phenylmethoxymethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-methylsulfonyloxyethyl] methanesulfonate |
|---|---|
| PubChem CID | 101076927 |
| Molecular Formula | C19H28O10S2 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | [(2R)-2-[(3aR,5S,6R,6aR)-2,2-dimethyl-6-(phenylmethoxymethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-methylsulfonyloxyethyl] methanesulfonate |
| SMILES | CC1(C)O[C@H]2O[C@H]([C@@H](COS(C)(=O)=O)OS(C)(=O)=O)[C@@H](COCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C19H28O10S2/c1-19(2)27-17-14(11-24-10-13-8-6-5-7-9-13)16(26-18(17)28-19)15(29-31(4,22)23)12-25-30(3,20)21/h5-9,14-18H,10-12H2,1-4H3/t14-,15-,16+,17-,18-/m1/s1 |
| InChIKey | PFMQBIZYYMDGNX-UYTYNIKBSA-N |
| XLogP | 1.02 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|