C24H30O8S — CID 11477122
[(3aR,5R,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-5-(phenylmethoxymethyl)-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-yl]methyl methanesulfonate (PubChem CID 11477122) has the molecular formula C24H30O8S and a molecular weight of 478.56 g/mol. Its IUPAC name is [(3aR,5R,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-5-(phenylmethoxymethyl)-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-yl]methyl methanesulfonate.
| Compound Name | [(3aR,5R,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-5-(phenylmethoxymethyl)-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 11477122 |
| Molecular Formula | C24H30O8S |
| Molecular Weight | 478.56 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | [(3aR,5R,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-5-(phenylmethoxymethyl)-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-yl]methyl methanesulfonate |
| SMILES | CC1(C)O[C@H]2O[C@H](COCc3ccccc3)[C@@](COS(C)(=O)=O)(OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C24H30O8S/c1-23(2)31-21-22(32-23)30-20(16-27-14-18-10-6-4-7-11-18)24(21,17-29-33(3,25)26)28-15-19-12-8-5-9-13-19/h4-13,20-22H,14-17H2,1-3H3/t20-,21+,22-,24-/m1/s1 |
| InChIKey | PGJBQSVDWSWVAB-JTOYRKQZSA-N |
| XLogP | 3.01 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.56 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|