C15H19F3O6S — CID 123946987
[2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]methyl trifluoromethanesulfonate (PubChem CID 123946987) has the molecular formula C15H19F3O6S and a molecular weight of 384.37 g/mol. Its IUPAC name is [2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]methyl trifluoromethanesulfonate.
| Compound Name | [2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]methyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 123946987 |
| Molecular Formula | C15H19F3O6S |
| Molecular Weight | 384.37 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | [2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxolan-4-yl]methyl trifluoromethanesulfonate |
| SMILES | CC1(C)OC(COCc2ccccc2)C(COS(=O)(=O)C(F)(F)F)O1 |
| InChI | InChI=1S/C15H19F3O6S/c1-14(2)23-12(9-21-8-11-6-4-3-5-7-11)13(24-14)10-22-25(19,20)15(16,17)18/h3-7,12-13H,8-10H2,1-2H3 |
| InChIKey | CKBSRAOARCGHKZ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|