About 3-phenylmethoxypropyl trifluoromethanesulfonate
3-phenylmethoxypropyl trifluoromethanesulfonate (PubChem CID 56850444) has the molecular formula C11H13F3O4S
and a molecular weight of 298.28 g/mol. Its IUPAC name is 3-phenylmethoxypropyl trifluoromethanesulfonate.
Molecular Properties
| Compound Name | 3-phenylmethoxypropyl trifluoromethanesulfonate |
| PubChem CID | 56850444 |
| Molecular Formula | C11H13F3O4S |
| Molecular Weight | 298.28 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 3-phenylmethoxypropyl trifluoromethanesulfonate |
| SMILES | O=S(=O)(OCCCOCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C11H13F3O4S/c12-11(13,14)19(15,16)18-8-4-7-17-9-10-5-2-1-3-6-10/h1-3,5-6H,4,7-9H2 |
| InChIKey | FZVGCCYWLKNBDN-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 3-phenylmethoxypropyl trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylmethoxypropyl trifluoromethanesulfonate?
The IUPAC name of 3-phenylmethoxypropyl trifluoromethanesulfonate (CID 56850444) is 3-phenylmethoxypropyl trifluoromethanesulfonate.
What is the SMILES notation for 3-phenylmethoxypropyl trifluoromethanesulfonate?
The canonical SMILES for 3-phenylmethoxypropyl trifluoromethanesulfonate is O=S(=O)(OCCCOCc1ccccc1)C(F)(F)F.
What is the InChIKey of 3-phenylmethoxypropyl trifluoromethanesulfonate?
The InChIKey is FZVGCCYWLKNBDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F3O4S/c12-11(13,14)19(15,16)18-8-4-7-17-9-10-5-2-1-3-6-10/h1-3,5-6H,4,7-9H2.
What are the key properties of 3-phenylmethoxypropyl trifluoromethanesulfonate?
3-phenylmethoxypropyl trifluoromethanesulfonate has a molecular weight of 298.28 g/mol, XLogP of 2.46, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylmethoxypropyl trifluoromethanesulfonate is sourced from PubChem (CID 56850444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).