About 4-phenylmethoxybutyl benzenesulfonate
4-phenylmethoxybutyl benzenesulfonate (PubChem CID 139894312) has the molecular formula C17H20O4S
and a molecular weight of 320.41 g/mol. Its IUPAC name is 4-phenylmethoxybutyl benzenesulfonate.
Molecular Properties
| Compound Name | 4-phenylmethoxybutyl benzenesulfonate |
| PubChem CID | 139894312 |
| Molecular Formula | C17H20O4S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 4-phenylmethoxybutyl benzenesulfonate |
| SMILES | O=S(=O)(OCCCCOCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H20O4S/c18-22(19,17-11-5-2-6-12-17)21-14-8-7-13-20-15-16-9-3-1-4-10-16/h1-6,9-12H,7-8,13-15H2 |
| InChIKey | BEZGUNYIHFLNKJ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 4-phenylmethoxybutyl benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenylmethoxybutyl benzenesulfonate?
The IUPAC name of 4-phenylmethoxybutyl benzenesulfonate (CID 139894312) is 4-phenylmethoxybutyl benzenesulfonate.
What is the SMILES notation for 4-phenylmethoxybutyl benzenesulfonate?
The canonical SMILES for 4-phenylmethoxybutyl benzenesulfonate is O=S(=O)(OCCCCOCc1ccccc1)c1ccccc1.
What is the InChIKey of 4-phenylmethoxybutyl benzenesulfonate?
The InChIKey is BEZGUNYIHFLNKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20O4S/c18-22(19,17-11-5-2-6-12-17)21-14-8-7-13-20-15-16-9-3-1-4-10-16/h1-6,9-12H,7-8,13-15H2.
What are the key properties of 4-phenylmethoxybutyl benzenesulfonate?
4-phenylmethoxybutyl benzenesulfonate has a molecular weight of 320.41 g/mol, XLogP of 3.39, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenylmethoxybutyl benzenesulfonate is sourced from PubChem (CID 139894312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).