About azane;(4-phenylphenyl)methyl trifluoromethanesulfonate
azane;(4-phenylphenyl)methyl trifluoromethanesulfonate (PubChem CID 175496971) has the molecular formula C14H14F3NO3S
and a molecular weight of 333.33 g/mol. Its IUPAC name is azane;(4-phenylphenyl)methyl trifluoromethanesulfonate.
Molecular Properties
| Compound Name | azane;(4-phenylphenyl)methyl trifluoromethanesulfonate |
| PubChem CID | 175496971 |
| Molecular Formula | C14H14F3NO3S |
| Molecular Weight | 333.33 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | azane;(4-phenylphenyl)methyl trifluoromethanesulfonate |
| SMILES | N.O=S(=O)(OCc1ccc(-c2ccccc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C14H11F3O3S.H3N/c15-14(16,17)21(18,19)20-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12;/h1-9H,10H2;1H3 |
| InChIKey | ILDIUJLMKMQZNV-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 78.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.33 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze azane;(4-phenylphenyl)methyl trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;(4-phenylphenyl)methyl trifluoromethanesulfonate?
The IUPAC name of azane;(4-phenylphenyl)methyl trifluoromethanesulfonate (CID 175496971) is azane;(4-phenylphenyl)methyl trifluoromethanesulfonate.
What is the SMILES notation for azane;(4-phenylphenyl)methyl trifluoromethanesulfonate?
The canonical SMILES for azane;(4-phenylphenyl)methyl trifluoromethanesulfonate is N.O=S(=O)(OCc1ccc(-c2ccccc2)cc1)C(F)(F)F.
What is the InChIKey of azane;(4-phenylphenyl)methyl trifluoromethanesulfonate?
The InChIKey is ILDIUJLMKMQZNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11F3O3S.H3N/c15-14(16,17)21(18,19)20-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12;/h1-9H,10H2;1H3.
What are the key properties of azane;(4-phenylphenyl)methyl trifluoromethanesulfonate?
azane;(4-phenylphenyl)methyl trifluoromethanesulfonate has a molecular weight of 333.33 g/mol, XLogP of 3.88, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;(4-phenylphenyl)methyl trifluoromethanesulfonate is sourced from PubChem (CID 175496971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).