C15H17F5O3 — CID 91314753
3-phenylmethoxypropyl 4,4,5,5,5-pentafluoropentanoate (PubChem CID 91314753) has the molecular formula C15H17F5O3 and a molecular weight of 340.29 g/mol. Its IUPAC name is 3-phenylmethoxypropyl 4,4,5,5,5-pentafluoropentanoate.
| Compound Name | 3-phenylmethoxypropyl 4,4,5,5,5-pentafluoropentanoate |
|---|---|
| PubChem CID | 91314753 |
| Molecular Formula | C15H17F5O3 |
| Molecular Weight | 340.29 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 3-phenylmethoxypropyl 4,4,5,5,5-pentafluoropentanoate |
| SMILES | O=C(CCC(F)(F)C(F)(F)F)OCCCOCc1ccccc1 |
| InChI | InChI=1S/C15H17F5O3/c16-14(17,15(18,19)20)8-7-13(21)23-10-4-9-22-11-12-5-2-1-3-6-12/h1-3,5-6H,4,7-11H2 |
| InChIKey | PRBAVUMPOZIYHD-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.29 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|