C18H22O6 — CID 101001366
(3aR,5R,6R,6aR)-2,2-dimethyl-5-(phenylmethoxymethyl)spiro[5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6,5'-oxolane]-2'-one (PubChem CID 101001366) has the molecular formula C18H22O6 and a molecular weight of 334.37 g/mol. Its IUPAC name is (3aR,5R,6R,6aR)-2,2-dimethyl-5-(phenylmethoxymethyl)spiro[5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6,5'-oxolane]-2'-one.
| Compound Name | (3aR,5R,6R,6aR)-2,2-dimethyl-5-(phenylmethoxymethyl)spiro[5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6,5'-oxolane]-2'-one |
|---|---|
| PubChem CID | 101001366 |
| Molecular Formula | C18H22O6 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | (3aR,5R,6R,6aR)-2,2-dimethyl-5-(phenylmethoxymethyl)spiro[5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6,5'-oxolane]-2'-one |
| SMILES | CC1(C)O[C@H]2O[C@H](COCc3ccccc3)[C@]3(CCC(=O)O3)[C@H]2O1 |
| InChI | InChI=1S/C18H22O6/c1-17(2)23-15-16(24-17)21-13(18(15)9-8-14(19)22-18)11-20-10-12-6-4-3-5-7-12/h3-7,13,15-16H,8-11H2,1-2H3/t13-,15+,16-,18-/m1/s1 |
| InChIKey | WAEMKESKLNNUKS-NOVWEMISSA-N |
| XLogP | 2.16 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |