C26H38O5 — CID 142827459
2,2-dimethyl-5-(phenylmethoxymethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole;2-methylpropane;phenylmethanol (PubChem CID 142827459) has the molecular formula C26H38O5 and a molecular weight of 430.59 g/mol. Its IUPAC name is 2,2-dimethyl-5-(phenylmethoxymethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole;2-methylpropane;phenylmethanol.
| Compound Name | 2,2-dimethyl-5-(phenylmethoxymethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole;2-methylpropane;phenylmethanol |
|---|---|
| PubChem CID | 142827459 |
| Molecular Formula | C26H38O5 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | 2,2-dimethyl-5-(phenylmethoxymethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole;2-methylpropane;phenylmethanol |
| SMILES | CC(C)C.CC1(C)OC2CC(COCc3ccccc3)OC2O1.OCc1ccccc1 |
| InChI | InChI=1S/C15H20O4.C7H8O.C4H10/c1-15(2)18-13-8-12(17-14(13)19-15)10-16-9-11-6-4-3-5-7-11;8-6-7-4-2-1-3-5-7;1-4(2)3/h3-7,12-14H,8-10H2,1-2H3;1-5,8H,6H2;4H,1-3H3 |
| InChIKey | XIMLSEZFDFFISG-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |