C17H24O4 — CID 134972307
(E)-3-[(4R,6R)-2,2-dimethyl-6-(phenylmethoxymethyl)-1,3-dioxan-4-yl]prop-2-en-1-ol (PubChem CID 134972307) has the molecular formula C17H24O4 and a molecular weight of 292.37 g/mol. Its IUPAC name is (E)-3-[(4R,6R)-2,2-dimethyl-6-(phenylmethoxymethyl)-1,3-dioxan-4-yl]prop-2-en-1-ol.
| Compound Name | (E)-3-[(4R,6R)-2,2-dimethyl-6-(phenylmethoxymethyl)-1,3-dioxan-4-yl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 134972307 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | (E)-3-[(4R,6R)-2,2-dimethyl-6-(phenylmethoxymethyl)-1,3-dioxan-4-yl]prop-2-en-1-ol |
| SMILES | CC1(C)O[C@@H](COCc2ccccc2)C[C@H](/C=C/CO)O1 |
| InChI | InChI=1S/C17H24O4/c1-17(2)20-15(9-6-10-18)11-16(21-17)13-19-12-14-7-4-3-5-8-14/h3-9,15-16,18H,10-13H2,1-2H3/b9-6+/t15-,16+/m0/s1 |
| InChIKey | SRYXNWRHKJIHMH-VKFONMJVSA-N |
| XLogP | 2.66 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|