C17H22O5 — CID 11483592
(E)-3-[(3aR,4R,6R,6aR)-2,2-dimethyl-4-phenylmethoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]prop-2-en-1-ol (PubChem CID 11483592) has the molecular formula C17H22O5 and a molecular weight of 306.36 g/mol. Its IUPAC name is (E)-3-[(3aR,4R,6R,6aR)-2,2-dimethyl-4-phenylmethoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]prop-2-en-1-ol.
| Compound Name | (E)-3-[(3aR,4R,6R,6aR)-2,2-dimethyl-4-phenylmethoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 11483592 |
| Molecular Formula | C17H22O5 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | (E)-3-[(3aR,4R,6R,6aR)-2,2-dimethyl-4-phenylmethoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]prop-2-en-1-ol |
| SMILES | CC1(C)O[C@H]2[C@H](OCc3ccccc3)O[C@H](/C=C/CO)[C@H]2O1 |
| InChI | InChI=1S/C17H22O5/c1-17(2)21-14-13(9-6-10-18)20-16(15(14)22-17)19-11-12-7-4-3-5-8-12/h3-9,13-16,18H,10-11H2,1-2H3/b9-6+/t13-,14-,15-,16-/m1/s1 |
| InChIKey | PGMGKKFCCWZSQR-NUTCUAJPSA-N |
| XLogP | 2.00 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|