C25H28O7 — CID 46185586
methyl 2-[(Z)-2-[(3aS,4S,6R,6aS)-2,2-dimethyl-4-phenylmethoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]ethenyl]-6-methoxybenzoate (PubChem CID 46185586) has the molecular formula C25H28O7 and a molecular weight of 440.49 g/mol. Its IUPAC name is methyl 2-[(Z)-2-[(3aS,4S,6R,6aS)-2,2-dimethyl-4-phenylmethoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]ethenyl]-6-methoxybenzoate.
| Compound Name | methyl 2-[(Z)-2-[(3aS,4S,6R,6aS)-2,2-dimethyl-4-phenylmethoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]ethenyl]-6-methoxybenzoate |
|---|---|
| PubChem CID | 46185586 |
| Molecular Formula | C25H28O7 |
| Molecular Weight | 440.49 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | methyl 2-[(Z)-2-[(3aS,4S,6R,6aS)-2,2-dimethyl-4-phenylmethoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]ethenyl]-6-methoxybenzoate |
| SMILES | COC(=O)c1c(/C=C\[C@H]2O[C@H](OCc3ccccc3)[C@H]3OC(C)(C)O[C@H]32)cccc1OC |
| InChI | InChI=1S/C25H28O7/c1-25(2)31-21-19(14-13-17-11-8-12-18(27-3)20(17)23(26)28-4)30-24(22(21)32-25)29-15-16-9-6-5-7-10-16/h5-14,19,21-22,24H,15H2,1-4H3/b14-13-/t19-,21+,22+,24+/m1/s1 |
| InChIKey | DTGXJDRZSPVJDH-WTIGRSNDSA-N |
| XLogP | 3.96 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.49 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |