C22H31O9P — CID 10648040
methyl (E)-3-[(3aS,4S,6R,6aS)-2,2-dimethyl-4-phenylmethoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-diethoxyphosphorylprop-2-enoate (PubChem CID 10648040) has the molecular formula C22H31O9P and a molecular weight of 470.46 g/mol. Its IUPAC name is methyl (E)-3-[(3aS,4S,6R,6aS)-2,2-dimethyl-4-phenylmethoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-diethoxyphosphorylprop-2-enoate.
| Compound Name | methyl (E)-3-[(3aS,4S,6R,6aS)-2,2-dimethyl-4-phenylmethoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-diethoxyphosphorylprop-2-enoate |
|---|---|
| PubChem CID | 10648040 |
| Molecular Formula | C22H31O9P |
| Molecular Weight | 470.46 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | methyl (E)-3-[(3aS,4S,6R,6aS)-2,2-dimethyl-4-phenylmethoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-diethoxyphosphorylprop-2-enoate |
| SMILES | CCOP(=O)(OCC)/C(=C/[C@H]1O[C@H](OCc2ccccc2)[C@H]2OC(C)(C)O[C@H]21)C(=O)OC |
| InChI | InChI=1S/C22H31O9P/c1-6-27-32(24,28-7-2)17(20(23)25-5)13-16-18-19(31-22(3,4)30-18)21(29-16)26-14-15-11-9-8-10-12-15/h8-13,16,18-19,21H,6-7,14H2,1-5H3/b17-13+/t16-,18+,19+,21+/m1/s1 |
| InChIKey | BHZWYSWVGUZGMO-PYJLKIPLSA-N |
| XLogP | 3.77 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|