C16H20O6 — CID 10638506
(3aS,4S,6S,6aS)-4-[(4-methoxyphenyl)methoxy]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carbaldehyde (PubChem CID 10638506) has the molecular formula C16H20O6 and a molecular weight of 308.33 g/mol. Its IUPAC name is (3aS,4S,6S,6aS)-4-[(4-methoxyphenyl)methoxy]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carbaldehyde.
| Compound Name | (3aS,4S,6S,6aS)-4-[(4-methoxyphenyl)methoxy]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carbaldehyde |
|---|---|
| PubChem CID | 10638506 |
| Molecular Formula | C16H20O6 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | (3aS,4S,6S,6aS)-4-[(4-methoxyphenyl)methoxy]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carbaldehyde |
| SMILES | COc1ccc(CO[C@H]2O[C@H](C=O)[C@@H]3OC(C)(C)O[C@H]23)cc1 |
| InChI | InChI=1S/C16H20O6/c1-16(2)21-13-12(8-17)20-15(14(13)22-16)19-9-10-4-6-11(18-3)7-5-10/h4-8,12-15H,9H2,1-3H3/t12-,13+,14+,15+/m1/s1 |
| InChIKey | WMBMPGOTFKIXHS-QPSCCSFWSA-N |
| XLogP | 1.66 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|