C30H44O8Si — CID 25223673
2-[[(3aS,4R,6R,7R,7aS)-7-[(4-methoxyphenyl)methoxy]-4-[(4-methoxyphenyl)methoxymethyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]oxy]ethyl-trimethylsilane (PubChem CID 25223673) has the molecular formula C30H44O8Si and a molecular weight of 560.76 g/mol. Its IUPAC name is 2-[[(3aS,4R,6R,7R,7aS)-7-[(4-methoxyphenyl)methoxy]-4-[(4-methoxyphenyl)methoxymethyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]oxy]ethyl-trimethylsilane.
| Compound Name | 2-[[(3aS,4R,6R,7R,7aS)-7-[(4-methoxyphenyl)methoxy]-4-[(4-methoxyphenyl)methoxymethyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]oxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 25223673 |
| Molecular Formula | C30H44O8Si |
| Molecular Weight | 560.76 g/mol |
| Exact Mass | 560.28 |
| IUPAC Name | 2-[[(3aS,4R,6R,7R,7aS)-7-[(4-methoxyphenyl)methoxy]-4-[(4-methoxyphenyl)methoxymethyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]oxy]ethyl-trimethylsilane |
| SMILES | COc1ccc(COC[C@H]2O[C@@H](OCC[Si](C)(C)C)[C@H](OCc3ccc(OC)cc3)[C@H]3OC(C)(C)O[C@H]32)cc1 |
| InChI | InChI=1S/C30H44O8Si/c1-30(2)37-26-25(20-33-18-21-8-12-23(31-3)13-9-21)36-29(34-16-17-39(5,6)7)28(27(26)38-30)35-19-22-10-14-24(32-4)15-11-22/h8-15,25-29H,16-20H2,1-7H3/t25-,26+,27+,28-,29-/m1/s1 |
| InChIKey | YRHGMSBGWGFEQP-JYJZCUDQSA-N |
| XLogP | 5.41 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.76 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|