C23H33O9P — CID 23413331
ethyl (Z)-3-[(3aS,4S,6R,6aS)-2,2-dimethyl-4-phenylmethoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-diethoxyphosphorylprop-2-enoate (PubChem CID 23413331) has the molecular formula C23H33O9P and a molecular weight of 484.48 g/mol. Its IUPAC name is ethyl (Z)-3-[(3aS,4S,6R,6aS)-2,2-dimethyl-4-phenylmethoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-diethoxyphosphorylprop-2-enoate.
| Compound Name | ethyl (Z)-3-[(3aS,4S,6R,6aS)-2,2-dimethyl-4-phenylmethoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-diethoxyphosphorylprop-2-enoate |
|---|---|
| PubChem CID | 23413331 |
| Molecular Formula | C23H33O9P |
| Molecular Weight | 484.48 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | ethyl (Z)-3-[(3aS,4S,6R,6aS)-2,2-dimethyl-4-phenylmethoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-diethoxyphosphorylprop-2-enoate |
| SMILES | CCOC(=O)/C(=C/[C@H]1O[C@H](OCc2ccccc2)[C@H]2OC(C)(C)O[C@H]21)P(=O)(OCC)OCC |
| InChI | InChI=1S/C23H33O9P/c1-6-26-21(24)18(33(25,28-7-2)29-8-3)14-17-19-20(32-23(4,5)31-19)22(30-17)27-15-16-12-10-9-11-13-16/h9-14,17,19-20,22H,6-8,15H2,1-5H3/b18-14-/t17-,19+,20+,22+/m1/s1 |
| InChIKey | XKTXDDZHGFAZFD-OLAPTYKMSA-N |
| XLogP | 4.16 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.48 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|