C36H38O4Sn — CID 135007843
[(Z)-1-[(3aS,4S,6S,7aS)-2,2-dimethyl-4-phenylmethoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]prop-1-en-2-yl]-triphenylstannane (PubChem CID 135007843) has the molecular formula C36H38O4Sn and a molecular weight of 653.41 g/mol. Its IUPAC name is [(Z)-1-[(3aS,4S,6S,7aS)-2,2-dimethyl-4-phenylmethoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]prop-1-en-2-yl]-triphenylstannane.
| Compound Name | [(Z)-1-[(3aS,4S,6S,7aS)-2,2-dimethyl-4-phenylmethoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]prop-1-en-2-yl]-triphenylstannane |
|---|---|
| PubChem CID | 135007843 |
| Molecular Formula | C36H38O4Sn |
| Molecular Weight | 653.41 g/mol |
| Exact Mass | 654.18 |
| IUPAC Name | [(Z)-1-[(3aS,4S,6S,7aS)-2,2-dimethyl-4-phenylmethoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-6-yl]prop-1-en-2-yl]-triphenylstannane |
| SMILES | C/C(=C\[C@@H]1C[C@@H]2OC(C)(C)O[C@@H]2[C@@H](OCc2ccccc2)O1)[Sn](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H23O4.3C6H5.Sn/c1-4-8-14-11-15-16(22-18(2,3)21-15)17(20-14)19-12-13-9-6-5-7-10-13;3*1-2-4-6-5-3-1;/h5-10,14-17H,11-12H2,1-3H3;3*1-5H;/t14-,15+,16+,17+;;;;/m1..../s1 |
| InChIKey | XXYZWATZJYQVHB-XGGCTCLRSA-N |
| XLogP | 5.49 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.41 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |