C22H23N2O7S+ — CID 124629434
(Z)-2-[(3aS,4R,6S,6aR)-2,2-dimethyl-4-phenylmethoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-1-(benzenesulfonyl)-2-hydroxyethenediazonium (PubChem CID 124629434) has the molecular formula C22H23N2O7S+ and a molecular weight of 459.50 g/mol. Its IUPAC name is (Z)-2-[(3aS,4R,6S,6aR)-2,2-dimethyl-4-phenylmethoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-1-(benzenesulfonyl)-2-hydroxyethenediazonium.
| Compound Name | (Z)-2-[(3aS,4R,6S,6aR)-2,2-dimethyl-4-phenylmethoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-1-(benzenesulfonyl)-2-hydroxyethenediazonium |
|---|---|
| PubChem CID | 124629434 |
| Molecular Formula | C22H23N2O7S+ |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | (Z)-2-[(3aS,4R,6S,6aR)-2,2-dimethyl-4-phenylmethoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-1-(benzenesulfonyl)-2-hydroxyethenediazonium |
| SMILES | CC1(C)O[C@@H]2[C@H](OCc3ccccc3)O[C@H](/C(O)=C(\[N+]#N)S(=O)(=O)c3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C22H22N2O7S/c1-22(2)30-18-17(16(25)20(24-23)32(26,27)15-11-7-4-8-12-15)29-21(19(18)31-22)28-13-14-9-5-3-6-10-14/h3-12,17-19,21H,13H2,1-2H3/p+1/b20-16-/t17-,18-,19+,21-/m1/s1 |
| InChIKey | WNFRNJXAZOPOJP-CGFOZUQZSA-O |
| XLogP | 3.50 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|