C19H26O4 — CID 101488085
(4S,6R)-2,2-dimethyl-4-[(1R)-1-[(2R)-oxiran-2-yl]prop-2-enyl]-6-(phenylmethoxymethyl)-1,3-dioxane (PubChem CID 101488085) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is (4S,6R)-2,2-dimethyl-4-[(1R)-1-[(2R)-oxiran-2-yl]prop-2-enyl]-6-(phenylmethoxymethyl)-1,3-dioxane.
| Compound Name | (4S,6R)-2,2-dimethyl-4-[(1R)-1-[(2R)-oxiran-2-yl]prop-2-enyl]-6-(phenylmethoxymethyl)-1,3-dioxane |
|---|---|
| PubChem CID | 101488085 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | (4S,6R)-2,2-dimethyl-4-[(1R)-1-[(2R)-oxiran-2-yl]prop-2-enyl]-6-(phenylmethoxymethyl)-1,3-dioxane |
| SMILES | C=C[C@@H]([C@@H]1CO1)[C@@H]1C[C@H](COCc2ccccc2)OC(C)(C)O1 |
| InChI | InChI=1S/C19H26O4/c1-4-16(18-13-21-18)17-10-15(22-19(2,3)23-17)12-20-11-14-8-6-5-7-9-14/h4-9,15-18H,1,10-13H2,2-3H3/t15-,16-,17+,18+/m1/s1 |
| InChIKey | CEELMUGXKWMBHL-BDXSIMOUSA-N |
| XLogP | 3.31 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|