C12H15BrO2 — CID 11086853
(2R,4R)-4-bromo-2-(phenylmethoxymethyl)oxolane (PubChem CID 11086853) has the molecular formula C12H15BrO2 and a molecular weight of 271.15 g/mol. Its IUPAC name is (2R,4R)-4-bromo-2-(phenylmethoxymethyl)oxolane.
| Compound Name | (2R,4R)-4-bromo-2-(phenylmethoxymethyl)oxolane |
|---|---|
| PubChem CID | 11086853 |
| Molecular Formula | C12H15BrO2 |
| Molecular Weight | 271.15 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | (2R,4R)-4-bromo-2-(phenylmethoxymethyl)oxolane |
| SMILES | Br[C@H]1CO[C@@H](COCc2ccccc2)C1 |
| InChI | InChI=1S/C12H15BrO2/c13-11-6-12(15-8-11)9-14-7-10-4-2-1-3-5-10/h1-5,11-12H,6-9H2/t11-,12-/m1/s1 |
| InChIKey | DSUKENWABUKFAX-VXGBXAGGSA-N |
| XLogP | 2.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.15 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|