C17H25NO2 — CID 106364286
3-(phenylmethoxymethyl)-1,2,3,5,5a,6,7,8,9,9a-decahydrobenzo[e][1,4]oxazepine (PubChem CID 106364286) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is 3-(phenylmethoxymethyl)-1,2,3,5,5a,6,7,8,9,9a-decahydrobenzo[e][1,4]oxazepine.
| Compound Name | 3-(phenylmethoxymethyl)-1,2,3,5,5a,6,7,8,9,9a-decahydrobenzo[e][1,4]oxazepine |
|---|---|
| PubChem CID | 106364286 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 3-(phenylmethoxymethyl)-1,2,3,5,5a,6,7,8,9,9a-decahydrobenzo[e][1,4]oxazepine |
| SMILES | c1ccc(COCC2CNC3CCCCC3CO2)cc1 |
| InChI | InChI=1S/C17H25NO2/c1-2-6-14(7-3-1)11-19-13-16-10-18-17-9-5-4-8-15(17)12-20-16/h1-3,6-7,15-18H,4-5,8-13H2 |
| InChIKey | KAHWPVBTRFPLTR-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |