About 2-(chloromethyl)oxirane;phenylmethanol;2-(phenylmethoxymethyl)oxirane
2-(chloromethyl)oxirane;phenylmethanol;2-(phenylmethoxymethyl)oxirane (PubChem CID 163898082) has the molecular formula C20H25ClO4
and a molecular weight of 364.87 g/mol. Its IUPAC name is 2-(chloromethyl)oxirane;phenylmethanol;2-(phenylmethoxymethyl)oxirane.
Molecular Properties
| Compound Name | 2-(chloromethyl)oxirane;phenylmethanol;2-(phenylmethoxymethyl)oxirane |
| PubChem CID | 163898082 |
| Molecular Formula | C20H25ClO4 |
| Molecular Weight | 364.87 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 2-(chloromethyl)oxirane;phenylmethanol;2-(phenylmethoxymethyl)oxirane |
| SMILES | ClCC1CO1.OCc1ccccc1.c1ccc(COCC2CO2)cc1 |
| InChI | InChI=1S/C10H12O2.C7H8O.C3H5ClO/c1-2-4-9(5-3-1)6-11-7-10-8-12-10;8-6-7-4-2-1-3-5-7;4-1-3-2-5-3/h1-5,10H,6-8H2;1-5,8H,6H2;3H,1-2H2 |
| InChIKey | QHKQVKRLXKPXLY-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 54.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.87 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(chloromethyl)oxirane;phenylmethanol;2-(phenylmethoxymethyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(chloromethyl)oxirane;phenylmethanol;2-(phenylmethoxymethyl)oxirane?
The IUPAC name of 2-(chloromethyl)oxirane;phenylmethanol;2-(phenylmethoxymethyl)oxirane (CID 163898082) is 2-(chloromethyl)oxirane;phenylmethanol;2-(phenylmethoxymethyl)oxirane.
What is the SMILES notation for 2-(chloromethyl)oxirane;phenylmethanol;2-(phenylmethoxymethyl)oxirane?
The canonical SMILES for 2-(chloromethyl)oxirane;phenylmethanol;2-(phenylmethoxymethyl)oxirane is ClCC1CO1.OCc1ccccc1.c1ccc(COCC2CO2)cc1.
What is the InChIKey of 2-(chloromethyl)oxirane;phenylmethanol;2-(phenylmethoxymethyl)oxirane?
The InChIKey is QHKQVKRLXKPXLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2.C7H8O.C3H5ClO/c1-2-4-9(5-3-1)6-11-7-10-8-12-10;8-6-7-4-2-1-3-5-7;4-1-3-2-5-3/h1-5,10H,6-8H2;1-5,8H,6H2;3H,1-2H2.
What are the key properties of 2-(chloromethyl)oxirane;phenylmethanol;2-(phenylmethoxymethyl)oxirane?
2-(chloromethyl)oxirane;phenylmethanol;2-(phenylmethoxymethyl)oxirane has a molecular weight of 364.87 g/mol, XLogP of 3.40, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(chloromethyl)oxirane;phenylmethanol;2-(phenylmethoxymethyl)oxirane is sourced from PubChem (CID 163898082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).