C29H50O6Si — CID 11226216
(Z,8R)-8-[tert-butyl(dimethyl)silyl]oxy-1-[(4R,6R)-2,2-dimethyl-6-(phenylmethoxymethyl)-1,3-dioxan-4-yl]non-2-ene-1,4-diol (PubChem CID 11226216) has the molecular formula C29H50O6Si and a molecular weight of 522.80 g/mol. Its IUPAC name is (Z,8R)-8-[tert-butyl(dimethyl)silyl]oxy-1-[(4R,6R)-2,2-dimethyl-6-(phenylmethoxymethyl)-1,3-dioxan-4-yl]non-2-ene-1,4-diol.
| Compound Name | (Z,8R)-8-[tert-butyl(dimethyl)silyl]oxy-1-[(4R,6R)-2,2-dimethyl-6-(phenylmethoxymethyl)-1,3-dioxan-4-yl]non-2-ene-1,4-diol |
|---|---|
| PubChem CID | 11226216 |
| Molecular Formula | C29H50O6Si |
| Molecular Weight | 522.80 g/mol |
| Exact Mass | 522.34 |
| IUPAC Name | (Z,8R)-8-[tert-butyl(dimethyl)silyl]oxy-1-[(4R,6R)-2,2-dimethyl-6-(phenylmethoxymethyl)-1,3-dioxan-4-yl]non-2-ene-1,4-diol |
| SMILES | C[C@H](CCCC(O)/C=C\C(O)C1C[C@H](COCc2ccccc2)OC(C)(C)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H50O6Si/c1-22(35-36(7,8)28(2,3)4)13-12-16-24(30)17-18-26(31)27-19-25(33-29(5,6)34-27)21-32-20-23-14-10-9-11-15-23/h9-11,14-15,17-18,22,24-27,30-31H,12-13,16,19-21H2,1-8H3/b18-17-/t22-,24?,25-,26?,27?/m1/s1 |
| InChIKey | UCYANRKZDHJAOD-RGEOIPQMSA-N |
| XLogP | 5.97 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.80 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|