C21H32O3Si — CID 15019528
tert-butyl-dimethyl-[(2R)-4-[(2S,3R)-2-methyl-3-(phenylmethoxymethyl)oxiran-2-yl]but-3-yn-2-yl]oxysilane (PubChem CID 15019528) has the molecular formula C21H32O3Si and a molecular weight of 360.57 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2R)-4-[(2S,3R)-2-methyl-3-(phenylmethoxymethyl)oxiran-2-yl]but-3-yn-2-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(2R)-4-[(2S,3R)-2-methyl-3-(phenylmethoxymethyl)oxiran-2-yl]but-3-yn-2-yl]oxysilane |
|---|---|
| PubChem CID | 15019528 |
| Molecular Formula | C21H32O3Si |
| Molecular Weight | 360.57 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | tert-butyl-dimethyl-[(2R)-4-[(2S,3R)-2-methyl-3-(phenylmethoxymethyl)oxiran-2-yl]but-3-yn-2-yl]oxysilane |
| SMILES | C[C@H](C#C[C@]1(C)O[C@@H]1COCc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H32O3Si/c1-17(24-25(6,7)20(2,3)4)13-14-21(5)19(23-21)16-22-15-18-11-9-8-10-12-18/h8-12,17,19H,15-16H2,1-7H3/t17-,19-,21+/m1/s1 |
| InChIKey | ZDVGVESEHHFADM-QFUCXCTJSA-N |
| XLogP | 4.77 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.57 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|