C19H28O3Si — CID 101213440
3-[(2R,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyloxiran-2-yl]-1-phenylprop-2-yn-1-ol (PubChem CID 101213440) has the molecular formula C19H28O3Si and a molecular weight of 332.52 g/mol. Its IUPAC name is 3-[(2R,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyloxiran-2-yl]-1-phenylprop-2-yn-1-ol.
| Compound Name | 3-[(2R,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyloxiran-2-yl]-1-phenylprop-2-yn-1-ol |
|---|---|
| PubChem CID | 101213440 |
| Molecular Formula | C19H28O3Si |
| Molecular Weight | 332.52 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 3-[(2R,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyloxiran-2-yl]-1-phenylprop-2-yn-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@]1(C)C#CC(O)c1ccccc1 |
| InChI | InChI=1S/C19H28O3Si/c1-18(2,3)23(5,6)21-14-17-19(4,22-17)13-12-16(20)15-10-8-7-9-11-15/h7-11,16-17,20H,14H2,1-6H3/t16?,17-,19+/m0/s1 |
| InChIKey | VXFCRIDTNVAIGS-WFTITGEASA-N |
| XLogP | 3.90 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.52 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|