C24H42O4Si2 — CID 25224031
tert-butyl-[[3-[4-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyloxiran-2-yl]buta-1,3-diynyl]-3-methyloxiran-2-yl]methoxy]-dimethylsilane (PubChem CID 25224031) has the molecular formula C24H42O4Si2 and a molecular weight of 450.77 g/mol. Its IUPAC name is tert-butyl-[[3-[4-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyloxiran-2-yl]buta-1,3-diynyl]-3-methyloxiran-2-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[3-[4-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyloxiran-2-yl]buta-1,3-diynyl]-3-methyloxiran-2-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 25224031 |
| Molecular Formula | C24H42O4Si2 |
| Molecular Weight | 450.77 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | tert-butyl-[[3-[4-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyloxiran-2-yl]buta-1,3-diynyl]-3-methyloxiran-2-yl]methoxy]-dimethylsilane |
| SMILES | CC1(C#CC#CC2(C)OC2CO[Si](C)(C)C(C)(C)C)OC1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H42O4Si2/c1-21(2,3)29(9,10)25-17-19-23(7,27-19)15-13-14-16-24(8)20(28-24)18-26-30(11,12)22(4,5)6/h19-20H,17-18H2,1-12H3 |
| InChIKey | ZEDVTVHDEYYHJX-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.77 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|