C14H30O4Si — CID 138967635
2-[(4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol (PubChem CID 138967635) has the molecular formula C14H30O4Si and a molecular weight of 290.48 g/mol. Its IUPAC name is 2-[(4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol.
| Compound Name | 2-[(4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol |
|---|---|
| PubChem CID | 138967635 |
| Molecular Formula | C14H30O4Si |
| Molecular Weight | 290.48 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | 2-[(4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol |
| SMILES | CC1(C)O[C@@H](CO[Si](C)(C)C(C)(C)C)[C@@H](CCO)O1 |
| InChI | InChI=1S/C14H30O4Si/c1-13(2,3)19(6,7)16-10-12-11(8-9-15)17-14(4,5)18-12/h11-12,15H,8-10H2,1-7H3/t11-,12+/m1/s1 |
| InChIKey | WMXIUPVUOUKRTQ-NEPJUHHUSA-N |
| XLogP | 2.91 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.48 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|