C31H56O11 — CID 90990197
2-[(4S,5R)-5-(2,2-dimethylpropanoyloxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl 2,2-dimethylpropanoate;[(4R,5S)-5-(2-hydroxyethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 2,2-dimethylpropanoate (PubChem CID 90990197) has the molecular formula C31H56O11 and a molecular weight of 604.78 g/mol. Its IUPAC name is 2-[(4S,5R)-5-(2,2-dimethylpropanoyloxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl 2,2-dimethylpropanoate;[(4R,5S)-5-(2-hydroxyethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | 2-[(4S,5R)-5-(2,2-dimethylpropanoyloxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl 2,2-dimethylpropanoate;[(4R,5S)-5-(2-hydroxyethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 90990197 |
| Molecular Formula | C31H56O11 |
| Molecular Weight | 604.78 g/mol |
| Exact Mass | 604.38 |
| IUPAC Name | 2-[(4S,5R)-5-(2,2-dimethylpropanoyloxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl 2,2-dimethylpropanoate;[(4R,5S)-5-(2-hydroxyethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC1(C)O[C@@H](CCO)[C@@H](COC(=O)C(C)(C)C)O1.CC1(C)O[C@@H](CCOC(=O)C(C)(C)C)[C@@H](COC(=O)C(C)(C)C)O1 |
| InChI | InChI=1S/C18H32O6.C13H24O5/c1-16(2,3)14(19)21-10-9-12-13(24-18(7,8)23-12)11-22-15(20)17(4,5)6;1-12(2,3)11(15)16-8-10-9(6-7-14)17-13(4,5)18-10/h12-13H,9-11H2,1-8H3;9-10,14H,6-8H2,1-5H3/t12-,13+;9-,10+/m00/s1 |
| InChIKey | DGTJKELUYBFODI-TYWHLNLWSA-N |
| XLogP | 4.55 |
| TPSA | 136.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.78 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|