C19H36O7 — CID 10523583
[(2R,3R,4S,6R)-6-[(2S)-2,3-dimethoxypropyl]-3-hydroxy-4-methoxy-5,5-dimethyloxan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 10523583) has the molecular formula C19H36O7 and a molecular weight of 376.49 g/mol. Its IUPAC name is [(2R,3R,4S,6R)-6-[(2S)-2,3-dimethoxypropyl]-3-hydroxy-4-methoxy-5,5-dimethyloxan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3R,4S,6R)-6-[(2S)-2,3-dimethoxypropyl]-3-hydroxy-4-methoxy-5,5-dimethyloxan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10523583 |
| Molecular Formula | C19H36O7 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | [(2R,3R,4S,6R)-6-[(2S)-2,3-dimethoxypropyl]-3-hydroxy-4-methoxy-5,5-dimethyloxan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | COC[C@H](C[C@H]1O[C@H](COC(=O)C(C)(C)C)[C@H](O)[C@@H](OC)C1(C)C)OC |
| InChI | InChI=1S/C19H36O7/c1-18(2,3)17(21)25-11-13-15(20)16(24-8)19(4,5)14(26-13)9-12(23-7)10-22-6/h12-16,20H,9-11H2,1-8H3/t12-,13+,14+,15-,16+/m0/s1 |
| InChIKey | CPTJBWWEBKWAEI-CQJMVSDSSA-N |
| XLogP | 1.80 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |