C25H50O7Si — CID 11027385
[(2R,3R,4S,6R)-6-[(2S)-2,3-dimethoxypropyl]-4-methoxy-5,5-dimethyl-3-triethylsilyloxyoxan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 11027385) has the molecular formula C25H50O7Si and a molecular weight of 490.75 g/mol. Its IUPAC name is [(2R,3R,4S,6R)-6-[(2S)-2,3-dimethoxypropyl]-4-methoxy-5,5-dimethyl-3-triethylsilyloxyoxan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3R,4S,6R)-6-[(2S)-2,3-dimethoxypropyl]-4-methoxy-5,5-dimethyl-3-triethylsilyloxyoxan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11027385 |
| Molecular Formula | C25H50O7Si |
| Molecular Weight | 490.75 g/mol |
| Exact Mass | 490.33 |
| IUPAC Name | [(2R,3R,4S,6R)-6-[(2S)-2,3-dimethoxypropyl]-4-methoxy-5,5-dimethyl-3-triethylsilyloxyoxan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC[Si](CC)(CC)O[C@@H]1[C@@H](OC)C(C)(C)[C@@H](C[C@@H](COC)OC)O[C@@H]1COC(=O)C(C)(C)C |
| InChI | InChI=1S/C25H50O7Si/c1-12-33(13-2,14-3)32-21-19(17-30-23(26)24(4,5)6)31-20(15-18(28-10)16-27-9)25(7,8)22(21)29-11/h18-22H,12-17H2,1-11H3/t18-,19+,20+,21-,22+/m0/s1 |
| InChIKey | BPWYIHGZRABSJT-AHJNKEMKSA-N |
| XLogP | 4.83 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.75 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|