C9H14O4 — CID 10419913
[(2S,3S)-3-formyloxiran-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 10419913) has the molecular formula C9H14O4 and a molecular weight of 186.21 g/mol. Its IUPAC name is [(2S,3S)-3-formyloxiran-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2S,3S)-3-formyloxiran-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10419913 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | [(2S,3S)-3-formyloxiran-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC[C@@H]1O[C@@H]1C=O |
| InChI | InChI=1S/C9H14O4/c1-9(2,3)8(11)12-5-7-6(4-10)13-7/h4,6-7H,5H2,1-3H3/t6-,7+/m1/s1 |
| InChIKey | RHQCYOLPIHNMAT-RQJHMYQMSA-N |
| XLogP | 0.54 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|