C11H17IO5 — CID 11760061
[(1S,3R,4R,5S)-5-hydroxy-6-iodo-2,7-dioxabicyclo[2.2.1]heptan-3-yl]methyl 2,2-dimethylpropanoate (PubChem CID 11760061) has the molecular formula C11H17IO5 and a molecular weight of 356.16 g/mol. Its IUPAC name is [(1S,3R,4R,5S)-5-hydroxy-6-iodo-2,7-dioxabicyclo[2.2.1]heptan-3-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(1S,3R,4R,5S)-5-hydroxy-6-iodo-2,7-dioxabicyclo[2.2.1]heptan-3-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11760061 |
| Molecular Formula | C11H17IO5 |
| Molecular Weight | 356.16 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | [(1S,3R,4R,5S)-5-hydroxy-6-iodo-2,7-dioxabicyclo[2.2.1]heptan-3-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC[C@H]1O[C@H]2O[C@@H]1[C@H](O)C2I |
| InChI | InChI=1S/C11H17IO5/c1-11(2,3)10(14)15-4-5-8-7(13)6(12)9(16-5)17-8/h5-9,13H,4H2,1-3H3/t5-,6?,7-,8+,9+/m1/s1 |
| InChIKey | MTCSHURQVXXKTN-CGAVGJTKSA-N |
| XLogP | 0.86 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.16 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|