C21H36O9 — CID 100926788
[(2R,3R,4S,5R,6S)-4,6-bis(2,2-dimethylpropanoyloxy)-3,5-dihydroxyoxan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 100926788) has the molecular formula C21H36O9 and a molecular weight of 432.51 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-4,6-bis(2,2-dimethylpropanoyloxy)-3,5-dihydroxyoxan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3R,4S,5R,6S)-4,6-bis(2,2-dimethylpropanoyloxy)-3,5-dihydroxyoxan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 100926788 |
| Molecular Formula | C21H36O9 |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-4,6-bis(2,2-dimethylpropanoyloxy)-3,5-dihydroxyoxan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC[C@H]1O[C@@H](OC(=O)C(C)(C)C)[C@H](O)[C@@H](OC(=O)C(C)(C)C)[C@@H]1O |
| InChI | InChI=1S/C21H36O9/c1-19(2,3)16(24)27-10-11-12(22)14(29-17(25)20(4,5)6)13(23)15(28-11)30-18(26)21(7,8)9/h11-15,22-23H,10H2,1-9H3/t11-,12-,13-,14+,15+/m1/s1 |
| InChIKey | HISFKMUKMYDLPX-ZSAUSMIDSA-N |
| XLogP | 1.57 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|