C33H56O15 — CID 102332761
[(2R,3R,4S,5R,6S)-6-[(2R,3R,4R,5R,6R)-4,5-dihydroxy-2-(hydroxymethyl)-6-methoxyoxan-3-yl]oxy-3,4,5-tris(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 102332761) has the molecular formula C33H56O15 and a molecular weight of 692.80 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-6-[(2R,3R,4R,5R,6R)-4,5-dihydroxy-2-(hydroxymethyl)-6-methoxyoxan-3-yl]oxy-3,4,5-tris(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3R,4S,5R,6S)-6-[(2R,3R,4R,5R,6R)-4,5-dihydroxy-2-(hydroxymethyl)-6-methoxyoxan-3-yl]oxy-3,4,5-tris(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 102332761 |
| Molecular Formula | C33H56O15 |
| Molecular Weight | 692.80 g/mol |
| Exact Mass | 692.36 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-6-[(2R,3R,4R,5R,6R)-4,5-dihydroxy-2-(hydroxymethyl)-6-methoxyoxan-3-yl]oxy-3,4,5-tris(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CO[C@@H]1O[C@H](CO)[C@H](O[C@@H]2O[C@H](COC(=O)C(C)(C)C)[C@@H](OC(=O)C(C)(C)C)[C@H](OC(=O)C(C)(C)C)[C@H]2OC(=O)C(C)(C)C)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C33H56O15/c1-30(2,3)26(37)42-15-17-21(46-27(38)31(4,5)6)22(47-28(39)32(7,8)9)23(48-29(40)33(10,11)12)25(44-17)45-20-16(14-34)43-24(41-13)19(36)18(20)35/h16-25,34-36H,14-15H2,1-13H3/t16-,17-,18-,19-,20+,21-,22+,23-,24-,25+/m1/s1 |
| InChIKey | KKNNWSKDSWRVEW-YOJZCWELSA-N |
| XLogP | 1.64 |
| TPSA | 202.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.80 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|