C19H30Cl3NO8 — CID 10767905
[(2R,3S,4R,5R,6R)-4-(2,2-dimethylpropanoyloxy)-3-hydroxy-6-methoxy-5-[(2,2,2-trichloroacetyl)amino]oxan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 10767905) has the molecular formula C19H30Cl3NO8 and a molecular weight of 506.81 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-4-(2,2-dimethylpropanoyloxy)-3-hydroxy-6-methoxy-5-[(2,2,2-trichloroacetyl)amino]oxan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3S,4R,5R,6R)-4-(2,2-dimethylpropanoyloxy)-3-hydroxy-6-methoxy-5-[(2,2,2-trichloroacetyl)amino]oxan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10767905 |
| Molecular Formula | C19H30Cl3NO8 |
| Molecular Weight | 506.81 g/mol |
| Exact Mass | 505.10 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-4-(2,2-dimethylpropanoyloxy)-3-hydroxy-6-methoxy-5-[(2,2,2-trichloroacetyl)amino]oxan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CO[C@@H]1O[C@H](COC(=O)C(C)(C)C)[C@@H](O)[C@H](OC(=O)C(C)(C)C)[C@H]1NC(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C19H30Cl3NO8/c1-17(2,3)15(26)29-8-9-11(24)12(31-16(27)18(4,5)6)10(13(28-7)30-9)23-14(25)19(20,21)22/h9-13,24H,8H2,1-7H3,(H,23,25)/t9-,10-,11-,12-,13-/m1/s1 |
| InChIKey | MTBNXVMNBDDBMI-SYLRKERUSA-N |
| XLogP | 2.12 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.81 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|