C15H20Cl3NO9 — CID 134936451
[(2R,3R,4R,5R,6R)-3,4-diacetyloxy-6-methoxy-5-[(2,2,2-trichloroacetyl)amino]oxan-2-yl]methyl acetate (PubChem CID 134936451) has the molecular formula C15H20Cl3NO9 and a molecular weight of 464.68 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6R)-3,4-diacetyloxy-6-methoxy-5-[(2,2,2-trichloroacetyl)amino]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R,6R)-3,4-diacetyloxy-6-methoxy-5-[(2,2,2-trichloroacetyl)amino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 134936451 |
| Molecular Formula | C15H20Cl3NO9 |
| Molecular Weight | 464.68 g/mol |
| Exact Mass | 463.02 |
| IUPAC Name | [(2R,3R,4R,5R,6R)-3,4-diacetyloxy-6-methoxy-5-[(2,2,2-trichloroacetyl)amino]oxan-2-yl]methyl acetate |
| SMILES | CO[C@@H]1O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1NC(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C15H20Cl3NO9/c1-6(20)25-5-9-11(26-7(2)21)12(27-8(3)22)10(13(24-4)28-9)19-14(23)15(16,17)18/h9-13H,5H2,1-4H3,(H,19,23)/t9-,10-,11+,12-,13-/m1/s1 |
| InChIKey | LNSVUPNOQYJLRX-UJPOAAIJSA-N |
| XLogP | 0.64 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.68 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|