C15H20F3NO9 — CID 3968415
[3,4-diacetyloxy-6-methoxy-5-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]methyl acetate (PubChem CID 3968415) has the molecular formula C15H20F3NO9 and a molecular weight of 415.32 g/mol. Its IUPAC name is [3,4-diacetyloxy-6-methoxy-5-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]methyl acetate.
| Compound Name | [3,4-diacetyloxy-6-methoxy-5-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 3968415 |
| Molecular Formula | C15H20F3NO9 |
| Molecular Weight | 415.32 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | [3,4-diacetyloxy-6-methoxy-5-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]methyl acetate |
| SMILES | COC1OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C15H20F3NO9/c1-6(20)25-5-9-11(26-7(2)21)12(27-8(3)22)10(13(24-4)28-9)19-14(23)15(16,17)18/h9-13H,5H2,1-4H3,(H,19,23) |
| InChIKey | RODRARKLKSOSPM-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.32 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|