C11H20O3 — CID 10058626
[(2S,3S)-3-propyloxiran-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 10058626) has the molecular formula C11H20O3 and a molecular weight of 200.28 g/mol. Its IUPAC name is [(2S,3S)-3-propyloxiran-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2S,3S)-3-propyloxiran-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10058626 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | [(2S,3S)-3-propyloxiran-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CCC[C@@H]1O[C@H]1COC(=O)C(C)(C)C |
| InChI | InChI=1S/C11H20O3/c1-5-6-8-9(14-8)7-13-10(12)11(2,3)4/h8-9H,5-7H2,1-4H3/t8-,9-/m0/s1 |
| InChIKey | VMFMJCWDUCOPMA-IUCAKERBSA-N |
| XLogP | 2.14 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|