C32H46O18 — CID 10395087
[(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[[(2S,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]methyl]oxan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 10395087) has the molecular formula C32H46O18 and a molecular weight of 718.70 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[[(2S,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]methyl]oxan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[[(2S,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]methyl]oxan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10395087 |
| Molecular Formula | C32H46O18 |
| Molecular Weight | 718.70 g/mol |
| Exact Mass | 718.27 |
| IUPAC Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[[(2S,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]methyl]oxan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](C[C@@H]2O[C@H](COC(=O)C(C)(C)C)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C32H46O18/c1-14(33)41-12-23-27(45-17(4)36)29(47-19(6)38)25(43-15(2)34)21(49-23)11-22-26(44-16(3)35)30(48-20(7)39)28(46-18(5)37)24(50-22)13-42-31(40)32(8,9)10/h21-30H,11-13H2,1-10H3/t21-,22-,23+,24+,25-,26-,27+,28+,29+,30+/m0/s1 |
| InChIKey | RUHMYEBRIDFPFS-XPMAXGSMSA-N |
| XLogP | 0.65 |
| TPSA | 228.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.70 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|