C16H19F3O4 — CID 10449413
[(2S,3S)-3-propyloxiran-2-yl]methyl (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 10449413) has the molecular formula C16H19F3O4 and a molecular weight of 332.32 g/mol. Its IUPAC name is [(2S,3S)-3-propyloxiran-2-yl]methyl (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(2S,3S)-3-propyloxiran-2-yl]methyl (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 10449413 |
| Molecular Formula | C16H19F3O4 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | [(2S,3S)-3-propyloxiran-2-yl]methyl (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | CCC[C@@H]1O[C@H]1COC(=O)[C@](OC)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C16H19F3O4/c1-3-7-12-13(23-12)10-22-14(20)15(21-2,16(17,18)19)11-8-5-4-6-9-11/h4-6,8-9,12-13H,3,7,10H2,1-2H3/t12-,13-,15+/m0/s1 |
| InChIKey | HLCAXSIRZHZLTC-KCQAQPDRSA-N |
| XLogP | 3.20 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|