C21H40O8Si — CID 11048613
(4R,4aS,6R,8S,8aR)-6-[(2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methoxypropyl]-8-methoxy-7,7-dimethyl-4a,6,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-4-carboxylic acid (PubChem CID 11048613) has the molecular formula C21H40O8Si and a molecular weight of 448.63 g/mol. Its IUPAC name is (4R,4aS,6R,8S,8aR)-6-[(2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methoxypropyl]-8-methoxy-7,7-dimethyl-4a,6,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-4-carboxylic acid.
| Compound Name | (4R,4aS,6R,8S,8aR)-6-[(2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methoxypropyl]-8-methoxy-7,7-dimethyl-4a,6,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-4-carboxylic acid |
|---|---|
| PubChem CID | 11048613 |
| Molecular Formula | C21H40O8Si |
| Molecular Weight | 448.63 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | (4R,4aS,6R,8S,8aR)-6-[(2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methoxypropyl]-8-methoxy-7,7-dimethyl-4a,6,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-4-carboxylic acid |
| SMILES | CO[C@H](CO[Si](C)(C)C(C)(C)C)C[C@H]1O[C@H]2[C@H](OCO[C@H]2C(=O)O)[C@@H](OC)C1(C)C |
| InChI | InChI=1S/C21H40O8Si/c1-20(2,3)30(8,9)28-11-13(24-6)10-14-21(4,5)18(25-7)16-15(29-14)17(19(22)23)27-12-26-16/h13-18H,10-12H2,1-9H3,(H,22,23)/t13-,14+,15-,16-,17+,18+/m0/s1 |
| InChIKey | FTBOPYYUBOWITF-YPLQCARHSA-N |
| XLogP | 3.05 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.63 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|