C12H24O4Si — CID 121003661
5-[tert-butyl(dimethyl)silyl]oxy-4-methoxypentane-2,3-dione (PubChem CID 121003661) has the molecular formula C12H24O4Si and a molecular weight of 260.41 g/mol. Its IUPAC name is 5-[tert-butyl(dimethyl)silyl]oxy-4-methoxypentane-2,3-dione.
| Compound Name | 5-[tert-butyl(dimethyl)silyl]oxy-4-methoxypentane-2,3-dione |
|---|---|
| PubChem CID | 121003661 |
| Molecular Formula | C12H24O4Si |
| Molecular Weight | 260.41 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 5-[tert-butyl(dimethyl)silyl]oxy-4-methoxypentane-2,3-dione |
| SMILES | COC(CO[Si](C)(C)C(C)(C)C)C(=O)C(C)=O |
| InChI | InChI=1S/C12H24O4Si/c1-9(13)11(14)10(15-5)8-16-17(6,7)12(2,3)4/h10H,8H2,1-7H3 |
| InChIKey | HOWLIGPQAXVRNQ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.41 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|