C12H25BrO3Si — CID 23254785
[(2R,3S)-3-bromo-1-[tert-butyl(dimethyl)silyl]oxybutan-2-yl] acetate (PubChem CID 23254785) has the molecular formula C12H25BrO3Si and a molecular weight of 325.32 g/mol. Its IUPAC name is [(2R,3S)-3-bromo-1-[tert-butyl(dimethyl)silyl]oxybutan-2-yl] acetate.
| Compound Name | [(2R,3S)-3-bromo-1-[tert-butyl(dimethyl)silyl]oxybutan-2-yl] acetate |
|---|---|
| PubChem CID | 23254785 |
| Molecular Formula | C12H25BrO3Si |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | [(2R,3S)-3-bromo-1-[tert-butyl(dimethyl)silyl]oxybutan-2-yl] acetate |
| SMILES | CC(=O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@H](C)Br |
| InChI | InChI=1S/C12H25BrO3Si/c1-9(13)11(16-10(2)14)8-15-17(6,7)12(3,4)5/h9,11H,8H2,1-7H3/t9-,11+/m0/s1 |
| InChIKey | NXMPGESMSDJQTE-GXSJLCMTSA-N |
| XLogP | 3.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|