C17H34O6Si — CID 178027599
methyl 3-[2-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxypropoxy]-2,2-dimethylpropanoate (PubChem CID 178027599) has the molecular formula C17H34O6Si and a molecular weight of 362.54 g/mol. Its IUPAC name is methyl 3-[2-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxypropoxy]-2,2-dimethylpropanoate.
| Compound Name | methyl 3-[2-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxypropoxy]-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 178027599 |
| Molecular Formula | C17H34O6Si |
| Molecular Weight | 362.54 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | methyl 3-[2-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxypropoxy]-2,2-dimethylpropanoate |
| SMILES | COC(=O)C(C)(C)COCC(CO[Si](C)(C)C(C)(C)C)OC(C)=O |
| InChI | InChI=1S/C17H34O6Si/c1-13(18)23-14(11-22-24(8,9)16(2,3)4)10-21-12-17(5,6)15(19)20-7/h14H,10-12H2,1-9H3 |
| InChIKey | XXALKWLXLHTNCX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.54 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|