C17H34O7Si — CID 10547692
[(2S,3R,4R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,2,3-trimethoxy-5-oxopentyl] acetate (PubChem CID 10547692) has the molecular formula C17H34O7Si and a molecular weight of 378.54 g/mol. Its IUPAC name is [(2S,3R,4R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,2,3-trimethoxy-5-oxopentyl] acetate.
| Compound Name | [(2S,3R,4R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,2,3-trimethoxy-5-oxopentyl] acetate |
|---|---|
| PubChem CID | 10547692 |
| Molecular Formula | C17H34O7Si |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | [(2S,3R,4R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,2,3-trimethoxy-5-oxopentyl] acetate |
| SMILES | COC(OC(C)=O)[C@@H](OC)[C@H](OC)[C@H](C=O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H34O7Si/c1-12(19)24-16(22-7)15(21-6)14(20-5)13(10-18)11-23-25(8,9)17(2,3)4/h10,13-16H,11H2,1-9H3/t13-,14-,15+,16?/m1/s1 |
| InChIKey | VLWFHOCWFYWZKM-JZWPEALZSA-N |
| XLogP | 2.39 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|