C27H53NO9Si2 — CID 52920984
[(2R,3S,4S,5R)-4-acetyloxy-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-1-oxohexan-2-yl] acetate (PubChem CID 52920984) has the molecular formula C27H53NO9Si2 and a molecular weight of 591.89 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-4-acetyloxy-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-1-oxohexan-2-yl] acetate.
| Compound Name | [(2R,3S,4S,5R)-4-acetyloxy-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-1-oxohexan-2-yl] acetate |
|---|---|
| PubChem CID | 52920984 |
| Molecular Formula | C27H53NO9Si2 |
| Molecular Weight | 591.89 g/mol |
| Exact Mass | 591.33 |
| IUPAC Name | [(2R,3S,4S,5R)-4-acetyloxy-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-1-oxohexan-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]([C@H](NC(=O)OC(C)(C)C)[C@H](C=O)OC(C)=O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H53NO9Si2/c1-18(30)34-20(16-29)22(28-24(32)36-25(3,4)5)23(35-19(2)31)21(37-39(14,15)27(9,10)11)17-33-38(12,13)26(6,7)8/h16,20-23H,17H2,1-15H3,(H,28,32)/t20-,21+,22+,23+/m0/s1 |
| InChIKey | CGHXQNUHPSDVIO-WBADGQHESA-N |
| XLogP | 5.35 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.89 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|