C20H41NO4Si — CID 89080770
tert-butyl N-[(3S,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-3-methyloct-7-en-4-yl]carbamate (PubChem CID 89080770) has the molecular formula C20H41NO4Si and a molecular weight of 387.64 g/mol. Its IUPAC name is tert-butyl N-[(3S,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-3-methyloct-7-en-4-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-3-methyloct-7-en-4-yl]carbamate |
|---|---|
| PubChem CID | 89080770 |
| Molecular Formula | C20H41NO4Si |
| Molecular Weight | 387.64 g/mol |
| Exact Mass | 387.28 |
| IUPAC Name | tert-butyl N-[(3S,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-3-methyloct-7-en-4-yl]carbamate |
| SMILES | C=C(O)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](NC(=O)OC(C)(C)C)[C@@H](C)CC |
| InChI | InChI=1S/C20H41NO4Si/c1-12-14(2)17(21-18(23)24-19(4,5)6)16(13-15(3)22)25-26(10,11)20(7,8)9/h14,16-17,22H,3,12-13H2,1-2,4-11H3,(H,21,23)/t14-,16+,17+/m0/s1 |
| InChIKey | NYBZRESKUREDIA-USXIJHARSA-N |
| XLogP | 5.78 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.64 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|