C13H28NO6P — CID 101252494
tert-butyl N-[(1R,2S,3S)-1-dimethoxyphosphoryl-1-hydroxy-3-methylpentan-2-yl]carbamate (PubChem CID 101252494) has the molecular formula C13H28NO6P and a molecular weight of 325.34 g/mol. Its IUPAC name is tert-butyl N-[(1R,2S,3S)-1-dimethoxyphosphoryl-1-hydroxy-3-methylpentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(1R,2S,3S)-1-dimethoxyphosphoryl-1-hydroxy-3-methylpentan-2-yl]carbamate |
|---|---|
| PubChem CID | 101252494 |
| Molecular Formula | C13H28NO6P |
| Molecular Weight | 325.34 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | tert-butyl N-[(1R,2S,3S)-1-dimethoxyphosphoryl-1-hydroxy-3-methylpentan-2-yl]carbamate |
| SMILES | CC[C@H](C)[C@H](NC(=O)OC(C)(C)C)[C@H](O)P(=O)(OC)OC |
| InChI | InChI=1S/C13H28NO6P/c1-8-9(2)10(11(15)21(17,18-6)19-7)14-12(16)20-13(3,4)5/h9-11,15H,8H2,1-7H3,(H,14,16)/t9-,10-,11+/m0/s1 |
| InChIKey | IAGUEKHRXWVXOC-GARJFASQSA-N |
| XLogP | 2.73 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|