C9H17F3NO5P — CID 101264812
tert-butyl N-(1-dimethoxyphosphoryl-2,2,2-trifluoroethyl)carbamate (PubChem CID 101264812) has the molecular formula C9H17F3NO5P and a molecular weight of 307.21 g/mol. Its IUPAC name is tert-butyl N-(1-dimethoxyphosphoryl-2,2,2-trifluoroethyl)carbamate.
| Compound Name | tert-butyl N-(1-dimethoxyphosphoryl-2,2,2-trifluoroethyl)carbamate |
|---|---|
| PubChem CID | 101264812 |
| Molecular Formula | C9H17F3NO5P |
| Molecular Weight | 307.21 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | tert-butyl N-(1-dimethoxyphosphoryl-2,2,2-trifluoroethyl)carbamate |
| SMILES | COP(=O)(OC)C(NC(=O)OC(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C9H17F3NO5P/c1-8(2,3)18-7(14)13-6(9(10,11)12)19(15,16-4)17-5/h6H,1-5H3,(H,13,14) |
| InChIKey | VDXXNOKOYZVDLV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.21 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|