C9H17F3N2O2 — CID 130681792
tert-butyl N-(3-amino-4,4,4-trifluorobutan-2-yl)carbamate (PubChem CID 130681792) has the molecular formula C9H17F3N2O2 and a molecular weight of 242.24 g/mol. Its IUPAC name is tert-butyl N-(3-amino-4,4,4-trifluorobutan-2-yl)carbamate.
| Compound Name | tert-butyl N-(3-amino-4,4,4-trifluorobutan-2-yl)carbamate |
|---|---|
| PubChem CID | 130681792 |
| Molecular Formula | C9H17F3N2O2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | tert-butyl N-(3-amino-4,4,4-trifluorobutan-2-yl)carbamate |
| SMILES | CC(NC(=O)OC(C)(C)C)C(N)C(F)(F)F |
| InChI | InChI=1S/C9H17F3N2O2/c1-5(6(13)9(10,11)12)14-7(15)16-8(2,3)4/h5-6H,13H2,1-4H3,(H,14,15) |
| InChIKey | UNVVVXVOYSRNCF-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |